For research use only. Not for therapeutic Use.
3,6-Dibromopyrazine-2,5-dicarbonitrile (Cat.No:L003674) is a vital chemical compound with diverse applications in organic synthesis. Its unique structure, featuring multiple bromine and cyano groups, imparts distinctive reactivity. This compound is employed as a key building block in the preparation of specialized materials and pharmaceutical agents. Its versatility and significance in synthetic chemistry make it a crucial component in the development of innovative products.
| Catalog Number | L003674 |
| CAS Number | 1391026-27-9 |
| Molecular Formula | C6Br2N4 |
| Purity | ≥95% |
| IUPAC Name | 3,6-dibromopyrazine-2,5-dicarbonitrile |
| InChI | InChI=1S/C6Br2N4/c7-5-3(1-9)11-6(8)4(2-10)12-5 |
| InChIKey | BZVZWWZUTZAEJY-UHFFFAOYSA-N |
| SMILES | C(#N)C1=C(N=C(C(=N1)Br)C#N)Br |
