For research use only. Not for therapeutic Use.
3,6-Dichloro-1H-pyrrolo[3,2-c]pyridine is a heterocyclic compound used in pharmaceutical research and organic synthesis. Its fused pyrrole and pyridine ring system, along with chlorine atoms at the 3 and 6 positions, makes it a versatile building block for the development of bioactive molecules. This compound is commonly employed in the synthesis of kinase inhibitors and other therapeutic agents. Its unique structure allows for chemical modifications, contributing to advancements in medicinal chemistry and the design of novel drug candidates.
CAS Number | 1956375-91-9 |
Molecular Formula | C7H4Cl2N2 |
Purity | ≥95% |
IUPAC Name | 3,6-dichloro-1H-pyrrolo[3,2-c]pyridine |
InChI | InChI=1S/C7H4Cl2N2/c8-5-3-10-6-1-7(9)11-2-4(5)6/h1-3,10H |
InChIKey | MLMFBOJJPAILLX-UHFFFAOYSA-N |