For research use only. Not for therapeutic Use.
3,6-Dihydroxyflavone(CAT: M002392) is a naturally occurring flavonoid compound found in certain plant species. Its mode of action involves being a flavonoid with potential biological activities. Pharmacologically, 3,6-dihydroxyflavone has been studied for various effects, including antioxidant, anti-inflammatory, and neuroprotective properties. It has shown promise in preclinical studies, demonstrating its potential as a natural antioxidant and its ability to modulate inflammatory responses. Additionally, 3,6-dihydroxyflavone has been investigated for its potential neuroprotective effects and its potential as a therapeutic agent for neurodegenerative diseases.
CAS Number | 108238-41-1 |
Molecular Formula | C15H10O4 |
Purity | ≥95% |
Target | Apoptosis |
Storage | Desiccate at RT |
IUPAC Name | 3,6-dihydroxy-2-phenylchromen-4-one |
InChI | InChI=1S/C15H10O4/c16-10-6-7-12-11(8-10)13(17)14(18)15(19-12)9-4-2-1-3-5-9/h1-8,16,18H |
InChIKey | XHLOLFKZCUCROE-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)C2=C(C(=O)C3=C(O2)C=CC(=C3)O)O |