For research use only. Not for therapeutic Use.
3,6-dimethyl-3,4-dihydro-2H-1,4-benzoxazine(Cat No.:L007665), is a chemical compound characterized by a benzoxazine ring with methyl groups at the 3 and 6 positions. This specific molecular structure is significant in organic synthesis and material science. Benzoxazines are renowned for their role as monomers in polymer chemistry, contributing to the formation of high-performance thermosetting polymers. These polymers exhibit excellent mechanical, thermal, and chemical properties, making them valuable in applications like aerospace, electronics, and automotive industries.
Catalog Number | L007665 |
CAS Number | 24033-49-6 |
Molecular Formula | C10H13NO |
Purity | ≥95% |
IUPAC Name | 3,6-dimethyl-3,4-dihydro-2H-1,4-benzoxazine |
InChI | InChI=1S/C10H13NO/c1-7-3-4-10-9(5-7)11-8(2)6-12-10/h3-5,8,11H,6H2,1-2H3 |
InChIKey | SEFPQGGFTLHJHO-UHFFFAOYSA-N |
SMILES | CC1COC2=C(N1)C=C(C=C2)C |