For research use only. Not for therapeutic Use.
3,6-Dimethylbenzene-1,2-diol(Cat No.:L022342), also known as 3,6-dimethylcatechol, is an aromatic compound used in organic synthesis and pharmaceutical research. The molecule features a benzene ring with two hydroxyl groups at the 1 and 2 positions, and methyl groups at the 3 and 6 positions. This structure provides unique reactivity, making it valuable as an intermediate in the synthesis of complex molecules, including pharmaceuticals, dyes, and fine chemicals. The hydroxyl groups allow for versatile chemical modifications, while the methyl groups influence the compound’s electronic properties, making it essential for researchers in medicinal chemistry and advanced material development.
CAS Number | 2785-78-6 |
Molecular Formula | C8H10O2 |
Purity | ≥95% |
IUPAC Name | 3,6-dimethylbenzene-1,2-diol |
InChI | InChI=1S/C8H10O2/c1-5-3-4-6(2)8(10)7(5)9/h3-4,9-10H,1-2H3 |
InChIKey | RGUZWBOJHNWZOK-UHFFFAOYSA-N |
SMILES | CC1=C(C(=C(C=C1)C)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |