For research use only. Not for therapeutic Use.
3,6-Dipyridin-3-yl-1,2,4,5-tetrazine (Cat.No:L003519) is a significant compound in materials science and coordination chemistry. Its unique tetrazine core and pyridine functional groups contribute to its versatile reactivity and potential applications in the development of specialized materials, including coordination polymers and molecular assemblies.
Catalog Number | L003519 |
CAS Number | 107599-30-4 |
Molecular Formula | C12H8N6 |
Purity | ≥95% |
IUPAC Name | 3,6-dipyridin-3-yl-1,2,4,5-tetrazine |
InChI | InChI=1S/C12H8N6/c1-3-9(7-13-5-1)11-15-17-12(18-16-11)10-4-2-6-14-8-10/h1-8H |
InChIKey | OLXAHCQKLVGQOG-UHFFFAOYSA-N |
SMILES | C1=CC(=CN=C1)C2=NN=C(N=N2)C3=CN=CC=C3 |