For research use only. Not for therapeutic Use.
3,6,9,12-Tetraoxatetradecane-1,14-dioic acid(Cat No.:L010054), is a chemical compound with applications in organic synthesis and as a building block in various chemical reactions. It is a long-chain dioic acid with four ether oxygen atoms and two carboxylic acid groups, positioned at positions 1 and 14 in the tetradecane backbone. This compound may be used as a linker or spacer molecule in the synthesis of more complex organic compounds. Its unique structure makes it valuable in the preparation of specialized materials and in pharmaceutical research.
CAS Number | 32775-08-9 |
Molecular Formula | C10H18O8 |
Purity | ≥95% |
Target | PROTAC Linkers |
Storage | 2-8°C |
IUPAC Name | 2-[2-[2-[2-(carboxymethoxy)ethoxy]ethoxy]ethoxy]acetic acid |
InChI | InChI=1S/C10H18O8/c11-9(12)7-17-5-3-15-1-2-16-4-6-18-8-10(13)14/h1-8H2,(H,11,12)(H,13,14) |
InChIKey | BEAPHLNTCMLNPR-UHFFFAOYSA-N |
SMILES | C(COCCOCC(=O)O)OCCOCC(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |