For research use only. Not for therapeutic Use.
3,7-Di-tert-butylnaphthalene-1-sulfonamide (Cat.No:L003703) is a notable chemical compound with diverse applications. Its structure, featuring tert-butyl groups and a sulfonamide moiety, imparts unique reactivity and properties. This compound serves as a valuable building block in the synthesis of specialized materials and pharmaceuticals. Its versatility makes it a crucial component in the development of various products across industries, highlighting its importance in the field of chemical synthesis and materials science.
CAS Number | 109688-05-3 |
Molecular Formula | C18H25NO2S |
Purity | ≥95% |
IUPAC Name | 3,7-ditert-butylnaphthalene-1-sulfonamide |
InChI | InChI=1S/C18H25NO2S/c1-17(2,3)13-8-7-12-9-14(18(4,5)6)11-16(15(12)10-13)22(19,20)21/h7-11H,1-6H3,(H2,19,20,21) |
InChIKey | ROZYSWATIIRKBN-UHFFFAOYSA-N |
SMILES | CC(C)(C)C1=CC2=C(C=C(C=C2C=C1)C(C)(C)C)S(=O)(=O)N |