For research use only. Not for therapeutic Use.
3,7-Dibromo-10-(4-octylphenyl)-10H-phenothiazine (Cat.No:L003742) is a significant chemical compound in materials science. Its unique structure, combining phenothiazine and octylphenyl moieties, imparts specialized properties. This compound serves as a crucial component in the development of organic electronic materials and semiconductors. Its tailored properties make it indispensable in the fabrication of optoelectronic devices.
CAS Number | 1791416-53-9 |
Molecular Formula | C26H27Br2NS |
Purity | ≥95% |
IUPAC Name | 3,7-dibromo-10-(4-octylphenyl)phenothiazine |
InChI | InChI=1S/C26H27Br2NS/c1-2-3-4-5-6-7-8-19-9-13-22(14-10-19)29-23-15-11-20(27)17-25(23)30-26-18-21(28)12-16-24(26)29/h9-18H,2-8H2,1H3 |
InChIKey | HVXWSDBRPSSLAF-UHFFFAOYSA-N |
SMILES | CCCCCCCCC1=CC=C(C=C1)N2C3=C(C=C(C=C3)Br)SC4=C2C=CC(=C4)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |