For research use only. Not for therapeutic Use.
3,8-Di-O-methylellagic acid is a naturally occurring polyphenolic compound, essential for advanced pharmaceutical and nutraceutical research. Known for its potent antioxidant and anti-inflammatory properties, this compound plays a crucial role in studying cancer prevention, cardiovascular health, and neuroprotection. Its unique structure allows for detailed analysis of biological pathways and therapeutic potential. 3,8-Di-O-methylellagic acid is highly valued for its purity and stability, making it an indispensable tool in the development of health-promoting supplements and therapeutic agents.
CAS Number | 2239-88-5 |
Molecular Formula | C16H10O8 |
Purity | ≥95% |
Target | Bacterial |
Storage | -20°C |
InChI | InChI=1S/C16H10O8/c1-21-11-7(17)3-5-9-10-6(15(19)23-13(9)11)4-8(18)12(22-2)14(10)24-16(5)20/h3-4,17-18H,1-2H3 |
InChIKey | KLAGYIBJNXLDTL-UHFFFAOYSA-N |
SMILES | COC1=C(C=C2C3=C1OC(=O)C4=CC(=C(C(=C43)OC2=O)OC)O)O |