For research use only. Not for therapeutic Use.
3,8-Dichloro-[1,2,4]triazolo[4,3-a]pyridine(Cat No.:L007233), is a chemical compound with a fused triazolopyridine ring system. Its molecular formula is C6H3Cl2N3. This compound is significant in medicinal chemistry and agrochemical research due to its potential biological activities. The dichloro substituents on the triazolopyridine core confer unique reactivity and influence the compound’s interactions with biological targets. Researchers explore derivatives of this compound for their antiviral, antibacterial, and antifungal properties. The compound’s specific structure and reactivity make it valuable in the design and synthesis of novel biologically active molecules, contributing to drug discovery efforts and advancements in medicinal chemistry research.
CAS Number | 22841-86-7 |
Molecular Formula | C6H3Cl2N3 |
Purity | ≥95% |
IUPAC Name | 3,8-dichloro-[1,2,4]triazolo[4,3-a]pyridine |
InChI | InChI=1S/C6H3Cl2N3/c7-4-2-1-3-11-5(4)9-10-6(11)8/h1-3H |
InChIKey | ZSKDUIISOKVWTF-UHFFFAOYSA-N |
SMILES | C1=CN2C(=NN=C2Cl)C(=C1)Cl |