For research use only. Not for therapeutic Use.
3,8-Diethynyl-1,10-phenanthroline (Cat.No:L003880) is a pivotal compound in organic chemistry. Its distinct structure, with multiple acetylene groups, grants it unique reactivity and potential applications. This compound serves as a valuable building block for the synthesis of specialized organic molecules with diverse functions, particularly in materials science and pharmaceutical research.
Catalog Number | L003880 |
CAS Number | 640297-84-3 |
Molecular Formula | C16H8N2 |
Purity | ≥95% |
IUPAC Name | 3,8-diethynyl-1,10-phenanthroline |
InChI | InChI=1S/C16H8N2/c1-3-11-7-13-5-6-14-8-12(4-2)10-18-16(14)15(13)17-9-11/h1-2,5-10H |
InChIKey | ZCPVSKKKVVMMPV-UHFFFAOYSA-N |
SMILES | C#CC1=CN=C2C(=C1)C=CC3=CC(=CN=C32)C#C |