Home
>
Isotope Labeled Compounds>Other Isotope Labeled Compounds>
>
(3aR,4R,5R,6aS)-4-[3-(Ethyleneketal)decanyl]hexahydro-5-hydroxy-2H-cyclopenta[b]furan-2-one-d15
For research use only. Not for therapeutic Use.
(3aR,4R,5R,6aS)-4-[3-(Ethyleneketal)decanyl]hexahydro-5-hydroxy-2H-cyclopenta[b]furan-2-one-d15 is a highly deuterated compound, where 15 hydrogen atoms are replaced with deuterium. This labeling is particularly valuable in advanced research studies, such as metabolic tracing, NMR spectroscopy, and mass spectrometry, as it allows for precise tracking of the compound’s behavior in chemical and biological systems. The deuterium atoms provide clear differentiation in analytical techniques without altering the compound’s core chemical and physical properties, making it useful for investigating reaction mechanisms and metabolic pathways.
Catalog Number | R011895 |
CAS Number | 1217783-38-4 |
Synonyms | [3aR-(3aα,4α,5β,6aα)]-4-[2-(2-Heptyl-1,3-dioxolan-2-yl)ethyl]hexahydro-5-hydroxy-2H-cyclopenta[b]furan-2-one-d15 |
Molecular Formula | C19H32O5 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (3aR,4R,5R,6aS)-5-hydroxy-4-[2-[2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecadeuterioheptyl)-1,3-dioxolan-2-yl]ethyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
InChI | InChI=1S/C19H32O5/c1-2-3-4-5-6-8-19(22-10-11-23-19)9-7-14-15-12-18(21)24-17(15)13-16(14)20/h14-17,20H,2-13H2,1H3/t14-,15-,16-,17+/m1/s1/i1D3,2D2,3D2,4D2,5D2,6D2,8D2 |
InChIKey | ATVQZEZXTPHWTH-KCEJTPJJSA-N |
SMILES | CCCCCCCC1(OCCO1)CCC2C(CC3C2CC(=O)O3)O |