For research use only. Not for therapeutic Use.
(3aR,6aS)-rel-Hexahydro-1H-furo[3,4-c]pyrrole(Cat No.:L034271)is a chiral, bicyclic heterocycle used in pharmaceutical research and organic synthesis. Its fused furo-pyrrole ring system offers unique stereochemistry, making it a valuable intermediate in the development of biologically active molecules, including potential drug candidates. The compound’s rigid structure and defined stereocenters allow for selective reactivity in various chemical transformations. Researchers in medicinal chemistry and synthetic organic chemistry utilize this compound to explore novel therapeutic agents and create complex, stereochemically precise molecules for drug discovery and advanced material applications.
CAS Number | 55129-05-0 |
Molecular Formula | C6H11NO |
Purity | ≥95% |
IUPAC Name | (3aR,6aS)-3,3a,4,5,6,6a-hexahydro-1H-furo[3,4-c]pyrrole |
InChI | InChI=1S/C6H11NO/c1-5-3-8-4-6(5)2-7-1/h5-7H,1-4H2/t5-,6+ |
InChIKey | HQQVXVKQOPZRBJ-OLQVQODUSA-N |
SMILES | C1C2COCC2CN1 |