Home
>
Catalysts and Ligands>Chiral nitrogen ligands> (3aS,3a'S,8aR,8a'R)-2,2'-(Ethane-1,1-diyl)bis(3a,8a-dihydro-8H-indeno[1,2-d]oxazole)
For research use only. Not for therapeutic Use.
(3aS,3a’S,8aR,8a’R)-2,2′-(Ethane-1,1-diyl)bis(3a,8a-dihydro-8H-indeno[1,2-d]oxazole)(Cat No.:L003176)is a chiral bis-oxazoline ligand widely used in asymmetric catalysis, particularly in enantioselective reactions. Its rigid bicyclic structure, featuring indeno-oxazole rings, provides high stereocontrol, making it essential for the synthesis of chiral compounds in pharmaceutical and fine chemical industries. The ethane-1,1-diyl linker between the two oxazoline units enhances its versatility in catalytic applications, allowing for efficient and selective synthesis of complex molecules. This compound is a key tool for researchers focused on advancing chiral chemistry and drug development.
CAS Number | 1091605-95-6 |
Molecular Formula | C22H20N2O2 |
Purity | ≥95% |
IUPAC Name | (3aR,8bS)-2-[1-[(3aR,8bS)-4,8b-dihydro-3aH-indeno[1,2-d][1,3]oxazol-2-yl]ethyl]-4,8b-dihydro-3aH-indeno[1,2-d][1,3]oxazole |
InChI | InChI=1S/C22H20N2O2/c1-12(21-23-19-15-8-4-2-6-13(15)10-17(19)25-21)22-24-20-16-9-5-3-7-14(16)11-18(20)26-22/h2-9,12,17-20H,10-11H2,1H3/t17-,18-,19+,20+/m1/s1 |
InChIKey | BCWZRUFCLMFNDN-ZRNYENFQSA-N |
SMILES | CC(C1=NC2C(O1)CC3=CC=CC=C23)C4=NC5C(O4)CC6=CC=CC=C56 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |