For research use only. Not for therapeutic Use.
(3β,5β,7α,12α)-3,7,12-Trihydroxy-cholestan-26-oic Acid (Cat No.:C000814) is a unique steroidal compound with hydroxyl groups at positions 3, 7, and 12, derived from cholestanol, a sterol found in cell membranes. This compound likely holds significance in studies related to lipid metabolism, cell membrane structure, and potential bioactive roles. Its structural features could influence cellular processes and receptor interactions. Researchers may investigate its effects on cholesterol homeostasis, bile acid synthesis, and lipid-related disorders. The compound’s distinct properties make it a potential target for understanding sterol-mediated signaling pathways and developing interventions for conditions linked to cholesterol regulation.
| Catalog Number | C000814 |
| CAS Number | 78608-74-9 |
| Molecular Formula | C₂₇H₄₆O₅ |
| Purity | ≥95% |
| Solubility | DMSO (Slightly), Methanol (Slightly, Sonicated) |
| Appearance | White to Light Grey Solid |
| Storage | 4°C, Inert atmosphere |
| IUPAC Name | (6R)-2-methyl-6-[(3S,5S,7R,8R,9S,10S,12S,13R,14S,17R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]heptanoic acid |
| InChI | InChI=1S/C27H46O5/c1-15(6-5-7-16(2)25(31)32)19-8-9-20-24-21(14-23(30)27(19,20)4)26(3)11-10-18(28)12-17(26)13-22(24)29/h15-24,28-30H,5-14H2,1-4H3,(H,31,32)/t15-,16?,17+,18+,19-,20+,21+,22-,23+,24+,26+,27-/m1/s1 |
| InChIKey | CNWPIIOQKZNXBB-XTZASNGSSA-N |
| SMILES | CC(CCCC(C)C(=O)O)C1CCC2C1(C(CC3C2C(CC4C3(CCC(C4)O)C)O)O)C |
| Reference | Schroepfer, G., et al.: Physiol. Rev., 80, 361 (2000); Bjorkhem, I.: J. Clin. Invest., 6, 725(2002); Bjorkhem, I., et al.: Arterio. hromb. Vascul. Biol., 22, 734 (2002) |
