For research use only. Not for therapeutic Use.
3JC-48-3 is a Myc/Max heterodimerization inhibitor.
| Catalog Number | I020897 |
| Synonyms | 3JC-48-3; 3JC48-3; 3JC 48-3; 3JC-483; 3JC-48 3; 3JC483; 3JC 48 3; |
| Molecular Formula | C21H16N4O5 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | methyl 4'-methyl-6-((7-nitrobenzo[c][1,2,5]oxadiazol-4-yl)amino)-[1,1'-biphenyl]-3-carboxylate |
| InChI | InChI=1S/C21H16N4O5/c1-12-3-5-13(6-4-12)15-11-14(21(26)29-2)7-8-16(15)22-17-9-10-18(25(27)28)20-19(17)23-30-24-20/h3-11,22H,1-2H3 |
| InChIKey | RQIVQXFEBIUJQL-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C2=C(NC3=CC=C([N+]([O-])=O)C4=NON=C43)C=CC(C(OC)=O)=C2)C=C1 |
