For research use only. Not for therapeutic Use.
(3R)-morpholine-3-carboxamide hydrochloride(Cat No.:L007583), is a chemical compound featuring a morpholine ring substituted with a carboxamide group at the 3-position, with a hydrochloride salt. This specific enantiomer (3R) has unique stereochemical properties significant in drug development. Researchers study its interactions with biological targets, exploring its potential pharmacological applications. Its specialized structure allows for precise binding in biological systems. The hydrochloride salt form enhances its solubility, facilitating laboratory handling and biological testing.
CAS Number | 1867908-80-2 |
Molecular Formula | C5H11ClN2O2 |
Purity | ≥95% |
IUPAC Name | (3R)-morpholine-3-carboxamide;hydrochloride |
InChI | InChI=1S/C5H10N2O2.ClH/c6-5(8)4-3-9-2-1-7-4;/h4,7H,1-3H2,(H2,6,8);1H/t4-;/m1./s1 |
InChIKey | UXLHIHZQLXTZSC-PGMHMLKASA-N |
SMILES | C1COCC(N1)C(=O)N.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |