Home
>
Chemical Reagents>Organic Building Blocks> (3R,4R)-4-(Benzyloxy)-3-((tert-butoxycarbonyl)amino)pentanoic acid
For research use only. Not for therapeutic Use.
(3R,4R)-4-(Benzyloxy)-3-((tert-butoxycarbonyl)amino)pentanoic acid is a chiral amino acid derivative characterized by a pentanoic acid backbone. The molecule features a benzyloxy group at the 4-position and a tert-butoxycarbonyl (Boc) protected amino group at the 3-position. Its stereochemistry is defined by the (3R,4R) configuration, indicating specific spatial arrangements of the atoms. This compound is often used in peptide synthesis and medicinal chemistry, serving as a building block for more complex structures.
CAS Number | 254101-11-6 |
Molecular Formula | C17H25NO5 |
Purity | ≥95% |
IUPAC Name | (3R,4R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylmethoxypentanoic acid |
InChI | InChI=1S/C17H25NO5/c1-12(22-11-13-8-6-5-7-9-13)14(10-15(19)20)18-16(21)23-17(2,3)4/h5-9,12,14H,10-11H2,1-4H3,(H,18,21)(H,19,20)/t12-,14-/m1/s1 |
InChIKey | FYZBABHQLFFCHH-TZMCWYRMSA-N |
SMILES | C[C@H]([C@@H](CC(=O)O)NC(=O)OC(C)(C)C)OCC1=CC=CC=C1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |