For research use only. Not for therapeutic Use.
(3R,4R)-A2-32-01(Cat No.:I017665)is a high-purity chemical compound primarily used in pharmaceutical and biochemical research. This stereoisomer of A2-32-01 features a specific configuration at the chiral centers (3R,4R), making it valuable in studies involving chirality and molecular interactions. It plays a key role in the development of advanced drug candidates, particularly in areas related to enzyme inhibition and receptor binding. Its precise structure and stability ensure reliable and reproducible results, making (3R,4R)-A2-32-01 ideal for pharmaceutical research focused on molecular specificity and drug development.
CAS Number | 1359752-95-6 |
Molecular Formula | C₁₉H₂₇NO₂ |
Purity | ≥95% |
Target | Anti-infection |
IUPAC Name | (3R,4R)-3-non-8-enyl-4-(2-pyridin-3-ylethyl)oxetan-2-one |
InChI | InChI=1S/C19H27NO2/c1-2-3-4-5-6-7-8-11-17-18(22-19(17)21)13-12-16-10-9-14-20-15-16/h2,9-10,14-15,17-18H,1,3-8,11-13H2/t17-,18-/m1/s1 |
InChIKey | WBHVHPLFRGISDD-QZTJIDSGSA-N |
SMILES | C=CCCCCCCC[C@@H]1[C@H](OC1=O)CCC2=CN=CC=C2 |
Reference | [1]. Zeiler E, et al. Development and characterization of improved β-lactone-based anti-virulence drugs targetingClpP. Bioorg Med Chem. 2012 Jan 15;20(2):583-91. |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |