For research use only. Not for therapeutic Use.
(3R,4S)-Tofacitinib(CAT: I000384) is a stereoisomer of Tofacitinib, a selective Janus kinase (JAK) inhibitor, primarily targeting JAK1 and JAK3. This inhibition disrupts the JAK-STAT signaling pathway, reducing the transcription of pro-inflammatory cytokines and modulating immune responses. The (3R,4S) configuration may offer distinct pharmacokinetic or pharmacodynamic properties compared to other isomers, providing unique insights into structure-activity relationships. Its primary application lies in the Inflammation/Immunology field, supporting research into autoimmune diseases such as rheumatoid arthritis, psoriasis, and inflammatory bowel disease. (3R,4S)-Tofacitinib is instrumental in developing targeted therapies for immune-mediated disorders.
| Catalog Number | I000384 |
| CAS Number | 1092578-46-5 |
| Synonyms | 3-[(3R,4S)-4-methyl-3-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]-3-oxopropanenitrile |
| Molecular Formula | C16H20N6O |
| Purity | ≥95% |
| Target | JAK |
| Solubility | DMSO |
| Storage | Store at -20C |
| IC50 | 1 nM |
| IUPAC Name | 3-[(3R,4S)-4-methyl-3-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]-3-oxopropanenitrile |
| InChI | InChI=1S/C16H20N6O/c1-11-5-8-22(14(23)3-6-17)9-13(11)21(2)16-12-4-7-18-15(12)19-10-20-16/h4,7,10-11,13H,3,5,8-9H2,1-2H3,(H,18,19,20)/t11-,13-/m0/s1 |
| InChIKey | UJLAWZDWDVHWOW-AAEUAGOBSA-N |
| SMILES | C[C@H]1CCN(C[C@@H]1N(C)C2=NC=NC3=C2C=CN3)C(=O)CC#N |
