For research use only. Not for therapeutic Use.
(-)-(3S)-3-Hydroxy Quinine (Cat No.: R005079) is a stereoisomer of Quinine, essential for advanced pharmaceutical and biochemical research. This compound is used to study the pharmacokinetics, metabolism, and therapeutic effects of Quinine. Its unique stereochemistry allows for detailed analysis of chiral interactions and biological activity. (-)-(3S)-3-Hydroxy Quinine is highly valued for its purity and stability, making it an indispensable tool in the development of effective antimalarial treatments and the exploration of Quinine’s broader medicinal applications.
Catalog Number | R005079 |
CAS Number | 78549-61-8 |
Synonyms | (8α,9R)-6’-Methoxycinchonan-3,9-diol; (3S)-3-Hydroxyquinine; (3S)-Hydroxyquinine; 3-Hydroxyquinine; |
Molecular Formula | C20H24N2O3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (2S,4S,5S)-5-ethenyl-2-[(R)-hydroxy-(6-methoxyquinolin-4-yl)methyl]-1-azabicyclo[2.2.2]octan-5-ol |
InChI | InChI=1S/C20H24N2O3/c1-3-20(24)12-22-9-7-13(20)10-18(22)19(23)15-6-8-21-17-5-4-14(25-2)11-16(15)17/h3-6,8,11,13,18-19,23-24H,1,7,9-10,12H2,2H3/t13-,18-,19+,20+/m0/s1 |
InChIKey | BSRUJCFCZKMFMB-YGHPHNMRSA-N |
SMILES | COC1=CC2=C(C=CN=C2C=C1)C(C3CC4CCN3CC4(C=C)O)O |