Home
>
Chemical Reagents>Heterocyclic Building Blocks> (3S,4R)-tert-Butyl 3-fluoro-4-hydroxypiperidine-1-carboxylate
For research use only. Not for therapeutic Use.
(3S,4R)-tert-Butyl 3-fluoro-4-hydroxypiperidine-1-carboxylate(Cat No.:L030098)is a high-purity intermediate used in pharmaceutical synthesis, particularly in the development of fluorinated compounds. Its unique stereochemistry, with specific (3S,4R) configuration, ensures precision in chiral synthesis, making it ideal for creating complex molecules with defined spatial arrangements. The presence of a fluoro group enhances its reactivity, providing versatility in various chemical reactions. This compound is essential for researchers focusing on drug design and discovery, offering reliable performance in advanced medicinal chemistry applications.
CAS Number | 955028-88-3 |
Molecular Formula | C10H18FNO3 |
Purity | ≥95% |
IUPAC Name | tert-butyl (3S,4R)-3-fluoro-4-hydroxypiperidine-1-carboxylate |
InChI | InChI=1S/C10H18FNO3/c1-10(2,3)15-9(14)12-5-4-8(13)7(11)6-12/h7-8,13H,4-6H2,1-3H3/t7-,8+/m0/s1 |
InChIKey | XRNLYXKYODGLMI-JGVFFNPUSA-N |
SMILES | CC(C)(C)OC(=O)N1CCC(C(C1)F)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |