For research use only. Not for therapeutic Use.
(3S,5R)-Fluvastatin-d6 sodium(Cat No.:S000441) is a deuterated version of (3S,5R)-fluvastatin, where six hydrogen atoms are replaced with deuterium. This form is used for advanced pharmacokinetic and metabolic studies. Fluvastatin is a cholesterol-lowering statin drug that primarily inhibits HMG-CoA reductase, an enzyme critical for cholesterol synthesis in the liver. The specific (3S,5R) enantiomer represents the biologically active form of the drug, enhancing its efficacy. The sodium salt enhances solubility and absorption. The deuterated variant, (3S,5R)-Fluvastatin-d6 sodium, helps in researching the drug’s behavior, stability, and potential metabolic pathways in the body.
Catalog Number | S000441 |
CAS Number | 2249799-35-5 |
Molecular Formula | C24H19D6FNNaO4 |
Purity | ≥95% |
Target | HMG-CoA Reductase (HMGCR) |
IUPAC Name | sodium;(E,3S,5R)-7-[3-(4-fluorophenyl)-1-(1,1,1,3,3,3-hexadeuteriopropan-2-yl)indol-2-yl]-3,5-dihydroxyhept-6-enoate |
InChI | InChI=1S/C24H26FNO4.Na/c1-15(2)26-21-6-4-3-5-20(21)24(16-7-9-17(25)10-8-16)22(26)12-11-18(27)13-19(28)14-23(29)30;/h3-12,15,18-19,27-28H,13-14H2,1-2H3,(H,29,30);/q;+1/p-1/b12-11+;/t18-,19-;/m0./s1/i1D3,2D3; |
InChIKey | ZGGHKIMDNBDHJB-WPPSXBOFSA-M |
SMILES | CC(C)N1C2=CC=CC=C2C(=C1C=CC(CC(CC(=O)[O-])O)O)C3=CC=C(C=C3)F.[Na+] |