For research use only. Not for therapeutic Use.
4-(1-Hydroxyethyl)benzoic acid is an aromatic hydroxy acid featuring a benzoic acid core with a hydroxyethyl group, commonly used in pharmaceutical and biochemical research. Its structure, combining both hydroxyl and carboxylic acid functionalities, allows for versatile applications in synthesizing bioactive compounds and studying biochemical interactions. This compound is valuable in drug development, particularly for creating molecules with enhanced solubility and reactivity. Its stability and functional versatility support its use in medicinal chemistry and as a precursor for complex organic synthesis.
CAS Number | 97364-15-3 |
Molecular Formula | C9H10O3 |
Purity | ≥95% |
IUPAC Name | 4-(1-hydroxyethyl)benzoic acid |
InChI | InChI=1S/C9H10O3/c1-6(10)7-2-4-8(5-3-7)9(11)12/h2-6,10H,1H3,(H,11,12) |
InChIKey | UBXQIJLWYJGCCO-UHFFFAOYSA-N |
SMILES | CC(C1=CC=C(C=C1)C(=O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |