For research use only. Not for therapeutic Use.
4-(1-Hydroxyethyl)pyridine is a functionalized pyridine compound used in pharmaceutical synthesis and chemical research. The hydroxyethyl group attached to the pyridine ring offers increased reactivity, making it a versatile intermediate in creating more complex molecular structures. This compound is particularly valuable in drug development, where it can be used as a building block for bioactive molecules, enhancing their solubility and pharmacokinetic properties. Its applications extend to materials science and agrochemicals, supporting the synthesis of targeted compounds for diverse research fields.
CAS Number | 23389-75-5 |
Molecular Formula | C7H9NO |
Purity | ≥95% |
IUPAC Name | 1-pyridin-4-ylethanol |
InChI | InChI=1S/C7H9NO/c1-6(9)7-2-4-8-5-3-7/h2-6,9H,1H3 |
InChIKey | HVOAMIOKNARIMR-UHFFFAOYSA-N |
SMILES | CC(C1=CC=NC=C1)O |