For research use only. Not for therapeutic Use.
4-(1-Hydroxyethyl)pyridine is a functionalized pyridine compound used in pharmaceutical synthesis and chemical research. The hydroxyethyl group attached to the pyridine ring offers increased reactivity, making it a versatile intermediate in creating more complex molecular structures. This compound is particularly valuable in drug development, where it can be used as a building block for bioactive molecules, enhancing their solubility and pharmacokinetic properties. Its applications extend to materials science and agrochemicals, supporting the synthesis of targeted compounds for diverse research fields.
| Catalog Number | L019243 |
| CAS Number | 23389-75-5 |
| Molecular Formula | C7H9NO |
| Purity | ≥95% |
| IUPAC Name | 1-pyridin-4-ylethanol |
| InChI | InChI=1S/C7H9NO/c1-6(9)7-2-4-8-5-3-7/h2-6,9H,1H3 |
| InChIKey | HVOAMIOKNARIMR-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=NC=C1)O |
