For research use only. Not for therapeutic Use.
4-(1-(Methoxycarbonyl)cyclopropyl)benzoic acid is an organic compound featuring a benzoic acid core with a methoxycarbonyl-substituted cyclopropyl group. It’s used in pharmaceutical and chemical research due to its unique structural properties. This compound is significant for synthesizing various chemical entities and potential drug candidates, reflecting its importance in medicinal chemistry and advanced material science.
CAS Number | 807382-47-4 |
Molecular Formula | C12H12O4 |
Purity | ≥95% |
Storage | -80°C |
IUPAC Name | 4-(1-methoxycarbonylcyclopropyl)benzoic acid |
InChI | InChI=1S/C12H12O4/c1-16-11(15)12(6-7-12)9-4-2-8(3-5-9)10(13)14/h2-5H,6-7H2,1H3,(H,13,14) |
InChIKey | GMOUXACCXBMBMS-UHFFFAOYSA-N |
SMILES | COC(=O)C1(CC1)C2=CC=C(C=C2)C(=O)O |