For research use only. Not for therapeutic Use.
4-(1-Methylazetidin-3-yl)aniline (Cat.No:L003892) is a crucial compound in pharmaceutical research. Its distinct azetidine and aniline moieties confer unique reactivity and biological activity. This compound serves as a valuable scaffold in the development of potential therapeutic agents. Its versatile nature makes it a key component in the quest for innovative drugs, highlighting its significance in contemporary medicinal chemistry and drug discovery endeavors.
Catalog Number | L003892 |
CAS Number | 1785022-35-6 |
Molecular Formula | C10H14N2 |
Purity | ≥95% |
IUPAC Name | 4-(1-methylazetidin-3-yl)aniline |
InChI | InChI=1S/C10H14N2/c1-12-6-9(7-12)8-2-4-10(11)5-3-8/h2-5,9H,6-7,11H2,1H3 |
InChIKey | RJDUTFFJFOWRHL-UHFFFAOYSA-N |
SMILES | CN1CC(C1)C2=CC=C(C=C2)N |