For research use only. Not for therapeutic Use.
4-(1-((tert-Butoxycarbonyl)amino)ethyl)benzoic acid is a benzoic acid derivative with a tert-butoxycarbonyl (Boc)-protected amino group attached to an ethyl side chain on the benzene ring. This compound is frequently used in organic synthesis, especially in peptide and drug development, due to its Boc-protected amine, which offers stability for selective deprotection and functionalization. Its structure allows it to serve as a versatile intermediate, supporting the creation of complex bioactive molecules and efficient synthesis pathways in medicinal chemistry applications.
CAS Number | 895577-21-6 |
Molecular Formula | C14H19NO4 |
Purity | ≥95% |
IUPAC Name | 4-[1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]benzoic acid |
InChI | InChI=1S/C14H19NO4/c1-9(15-13(18)19-14(2,3)4)10-5-7-11(8-6-10)12(16)17/h5-9H,1-4H3,(H,15,18)(H,16,17) |
InChIKey | OKRPFRUXMOYTDV-UHFFFAOYSA-N |
SMILES | CC(C1=CC=C(C=C1)C(=O)O)NC(=O)OC(C)(C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |