For research use only. Not for therapeutic Use.
4-(10,15,20-Triphenylporphyrin-5-yl)phenol (Cat.No:L003773) is a pivotal compound in the field of organic chemistry. Its unique structure incorporates a phenol group and a porphyrin ring, conferring distinct properties. This compound finds applications in various areas, including catalysis and photophysics. It serves as a valuable scaffold for the synthesis of specialized molecules with diverse industrial and research applications.
Catalog Number | L003773 |
CAS Number | 87345-22-0 |
Molecular Formula | C44H30N4O |
Purity | ≥95% |
IUPAC Name | 4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)phenol |
InChI | InChI=1S/C44H30N4O/c49-32-18-16-31(17-19-32)44-39-26-24-37(47-39)42(29-12-6-2-7-13-29)35-22-20-33(45-35)41(28-10-4-1-5-11-28)34-21-23-36(46-34)43(30-14-8-3-9-15-30)38-25-27-40(44)48-38/h1-27,45,48-49H |
InChIKey | QMONKZRPMBDZDY-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)C2=C3C=CC(=C(C4=NC(=C(C5=CC=C(N5)C(=C6C=CC2=N6)C7=CC=CC=C7)C8=CC=C(C=C8)O)C=C4)C9=CC=CC=C9)N3 |