For research use only. Not for therapeutic Use.
4-(1,3,2-Dioxaborinan-2-yl)benzonitrile(CAT: L000334) plays a significant role in the fields of organic chemistry and materials science. This compound, with its unique boron-containing heterocycle, is a valuable reagent for organic synthesis. It is often utilized in organic chemistry as a key component for the Suzuki-Miyaura cross-coupling reaction, enabling the efficient synthesis of various biaryl compounds.
CAS Number | 152846-62-3 |
Molecular Formula | C10H10BNO2 |
Purity | ≥95% |
IUPAC Name | 4-(1,3,2-dioxaborinan-2-yl)benzonitrile |
InChI | InChI=1S/C10H10BNO2/c12-8-9-2-4-10(5-3-9)11-13-6-1-7-14-11/h2-5H,1,6-7H2 |
InChIKey | PHTWFPYKDUPZDN-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |