Home
>
Catalysts and Ligands>Nonchiral phosphine ligands> 4-(1,3,5-Triaza-7-phosphaadamantan-1-ium-1-yl)butane-1-sulfonate
For research use only. Not for therapeutic Use.
4-(1,3,5-Triaza-7-phosphaadamantan-1-ium-1-yl)butane-1-sulfonate (Cat.No:L003750) is a significant compound in chemical synthesis. Its unique structure, featuring a phosphonium and sulfonate group, imparts distinctive reactivity. This compound is utilized as a valuable reagent in various organic transformations, particularly in the field of catalysis and materials science. Its versatile nature makes it a crucial component in the development of specialized molecules.
CAS Number | 1430837-91-4 |
Molecular Formula | C10H20N3O3PS |
Purity | ≥95% |
IUPAC Name | 4-(3,5-diaza-1-azonia-7-phosphatricyclo[3.3.1.13,7]decan-1-yl)butane-1-sulfonate |
InChI | InChI=1S/C10H20N3O3PS/c14-18(15,16)4-2-1-3-13-6-11-5-12(7-13)9-17(8-11)10-13/h1-10H2 |
InChIKey | KGJWBSOVUYDJAT-UHFFFAOYSA-N |
SMILES | C1N2C[N+]3(CN1CP(C2)C3)CCCCS(=O)(=O)[O-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |