For research use only. Not for therapeutic Use.
4-(1H-imidazol-1-yl)benzoic acid hydrochloride(Cat No.:L007694), is a chemical compound featuring a benzoic acid core substituted with an imidazole ring at the 1-position. This specific molecular structure is significant in organic synthesis and medicinal chemistry. Researchers utilize it as a valuable intermediate in creating various organic molecules, especially in developing pharmaceuticals and fine chemicals. Its versatile nature allows for diverse chemical modifications, making it valuable in the design and synthesis of novel compounds for drug discovery, research purposes, and industrial applications, contributing to advancements in chemical research and chemical development.
CAS Number | 249292-42-0 |
Molecular Formula | C10H9ClN2O2 |
Purity | ≥95% |
Storage | Room Temperature |
IUPAC Name | 4-imidazol-1-ylbenzoic acid;hydrochloride |
InChI | InChI=1S/C10H8N2O2.ClH/c13-10(14)8-1-3-9(4-2-8)12-6-5-11-7-12;/h1-7H,(H,13,14);1H |
InChIKey | WVFHVTAOWAKGFT-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1C(=O)O)N2C=CN=C2.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |