For research use only. Not for therapeutic Use.
4(1H)-Pyrimidinone, 2,3-dihydro-2-selenoxo- (9CI)（Cat No.:M079980） is a chemical compound characterized by a pyrimidinone base structure modified with a selenoxo group at the 2-position. This modification introduces a selenium atom double-bonded to oxygen, adding unique chemical properties compared to sulfur or oxygen analogs. The structure includes a partially saturated pyrimidine ring, making it a versatile intermediate in organic synthesis. This compound is of interest in medicinal chemistry and materials science due to selenium’s potential antioxidant properties and its ability to mimic enzymatic activity, thus finding applications in drug development and catalysis.
| Catalog Number | M079980 |
| CAS Number | 16724-03-1 |
| Molecular Formula | C4H3N2OSe |
| Purity | ≥95% |
| Target | NF-κB |
| Storage | -20°C |
| InChI | InChI=1S/C4H3N2OSe/c7-3-1-2-5-4(8)6-3/h1-2H,(H,5,6,7) |
| InChIKey | DORROJBNUAGYSZ-UHFFFAOYSA-N |
| SMILES | C1=CN=C(NC1=O)[Se] |
