For research use only. Not for therapeutic Use.
4-(2-(2-Ethoxyethoxy)ethoxy)aniline(CAT: L031647) is an organic compound that consists of an aniline group (a benzene ring with an amino group at the 4-position) attached to a chain of ethoxyethoxyethoxy groups. This structure, which includes three repeating ethoxy units, imparts increased solubility and flexibility, making it useful in the synthesis of various polymers and materials. The amino group adds reactivity, allowing it to participate in reactions such as coupling, polymerization, or condensation, which makes it an important intermediate in producing functionalized materials, dyes, or advanced pharmaceutical agents. Its ethoxy-rich side chain can also influence the hydrophilicity and physical properties of the final products.
CAS Number | 90688-48-5 |
Molecular Formula | C12H19NO3 |
Purity | ≥95% |
IUPAC Name | 4-[2-(2-ethoxyethoxy)ethoxy]aniline |
InChI | InChI=1S/C12H19NO3/c1-2-14-7-8-15-9-10-16-12-5-3-11(13)4-6-12/h3-6H,2,7-10,13H2,1H3 |
InChIKey | ZPPAIDISWIOLFL-UHFFFAOYSA-N |