For research use only. Not for therapeutic Use.
4-(2-Aminoethyl)cyclohexanol(Cat No.:M137059) is a compound consisting of a cyclohexane ring with a hydroxyl group and an aminoethyl group attached. It exists as a mixture of cis and trans isomers. This compound is of interest in organic synthesis and pharmaceutical research due to its structural features, which make it a versatile building block for the synthesis of various bioactive molecules and pharmaceuticals. The cis and trans isomers may exhibit different properties and reactivity, which could impact their suitability for different applications.
CAS Number | 148356-06-3 |
Molecular Formula | C8H17NO |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 4-(2-aminoethyl)cyclohexan-1-ol |
InChI | InChI=1S/C8H17NO/c9-6-5-7-1-3-8(10)4-2-7/h7-8,10H,1-6,9H2 |
InChIKey | FNHBFOVJIPXNFL-UHFFFAOYSA-N |
SMILES | C1CC(CCC1CCN)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |