For research use only. Not for therapeutic Use.
(4-(2-Aminoethyl)phenyl)boronic acid(CAT: L000221) is a significant compound in organic chemistry, particularly in the field of synthesis. It serves as a valuable intermediate for creating various organic compounds, including pharmaceutical agents and organic intermediates. The presence of the boronic acid functionality allows for specific structural modifications, making it a key component for researchers in the design and synthesis of complex molecules.
CAS Number | 68162-46-9 |
Molecular Formula | C8H12BNO2 |
Purity | ≥95% |
IUPAC Name | [4-(2-aminoethyl)phenyl]boronic acid |
InChI | InChI=1S/C8H12BNO2/c10-6-5-7-1-3-8(4-2-7)9(11)12/h1-4,11-12H,5-6,10H2 |
InChIKey | ZUWSXKQTYHDETD-UHFFFAOYSA-N |