For research use only. Not for therapeutic Use.
4-(2-Boc-aminoethyl)piperidine (CAT: R038125) is a crucial intermediate in organic synthesis and medicinal chemistry. Acting as a protecting group, it shields the amino functionality temporarily. Its mode of action involves incorporating the compound into specific reactions, where the Boc group can be easily removed under controlled conditions to reveal the free amino group. This compound finds applications in the synthesis of pharmaceutical agents and biologically active molecules. Its pharmacologic action lies in facilitating the development of new drugs and aiding research in medicinal chemistry.
CAS Number | 165528-81-4 |
Molecular Formula | C12H24N2O2 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | tert-butyl N-(2-piperidin-4-ylethyl)carbamate |
InChI | InChI=1S/C12H24N2O2/c1-12(2,3)16-11(15)14-9-6-10-4-7-13-8-5-10/h10,13H,4-9H2,1-3H3,(H,14,15) |
InChIKey | RQRMFFGCUUGYPC-UHFFFAOYSA-N |
SMILES | CC(C)(C)OC(=O)NCCC1CCNCC1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |