For research use only. Not for therapeutic Use.
4-(2-Chlorophenyl)piperidine hydrochloride(CAT: L023981) is an organic compound consisting of a piperidine ring attached to a 2-chlorophenyl group at the 4th position, with the hydrochloride form improving its solubility and stability. This compound is frequently used as an intermediate in the synthesis of pharmaceutical agents, particularly in drug discovery and medicinal chemistry. The piperidine ring is a common motif in bioactive molecules, and the presence of the 2-chlorophenyl group enhances its potential for biological activity. The hydrochloride salt makes it easier to handle in various reactions, allowing for controlled reactions such as amide formation, coupling reactions, and other modifications in the preparation of more complex molecules.
CAS Number | 82211-92-5 |
Molecular Formula | C11H15Cl2N |
Purity | ≥95% |
IUPAC Name | 4-(2-chlorophenyl)piperidine;hydrochloride |
InChI | InChI=1S/C11H14ClN.ClH/c12-11-4-2-1-3-10(11)9-5-7-13-8-6-9;/h1-4,9,13H,5-8H2;1H |
InChIKey | BALIJVUSWGOXBJ-UHFFFAOYSA-N |