For research use only. Not for therapeutic Use.
4-(2-Fluoro-3-nitrophenyl)pyridine is an organic compound with the molecular formula C₁₁H₈FN₃O₂. It features a pyridine ring substituted with a 2-fluoro-3-nitrophenyl group at the 4-position. This compound typically appears as a solid and is of interest in medicinal chemistry for its potential applications in drug development. The combination of fluorine and nitro groups may enhance its biological activity, making it a candidate for exploring new therapeutic agents. Its unique structure also offers opportunities for further research in organic synthesis.
CAS Number | 1214391-68-0 |
Molecular Formula | C11H7FN2O2 |
Purity | ≥95% |
IUPAC Name | 4-(2-fluoro-3-nitrophenyl)pyridine |
InChI | InChI=1S/C11H7FN2O2/c12-11-9(8-4-6-13-7-5-8)2-1-3-10(11)14(15)16/h1-7H |
InChIKey | BTILGGLZBVUFGB-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C(=C1)[N+](=O)[O-])F)C2=CC=NC=C2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |