Home
>
Inhibitors/Agonists>Endocrinology and Hormones>Other Inhibitors>
>
4-(2-Fluorobenzyl)piperidine hydrochloride
For research use only. Not for therapeutic Use.
4-(2-Fluorobenzyl)piperidine hydrochloride (Cat.No:L031803) is a chemical compound used in medicinal chemistry research. It’s a piperidine derivative containing a fluorobenzyl group, which imparts specific reactivity and pharmacological properties. This compound serves as a valuable intermediate for synthesizing various bioactive molecules and exploring their potential applications in drug discovery.
Catalog Number | L031803 |
CAS Number | 193357-26-5 |
Molecular Formula | C12H17ClFN |
Purity | ≥95% |
IUPAC Name | 4-[(2-fluorophenyl)methyl]piperidine;hydrochloride |
InChI | InChI=1S/C12H16FN.ClH/c13-12-4-2-1-3-11(12)9-10-5-7-14-8-6-10;/h1-4,10,14H,5-9H2;1H |
InChIKey | PXFXMIWBLWWLLL-UHFFFAOYSA-N |