For research use only. Not for therapeutic Use.
4-[(2-Formylphenoxy)methyl]benzoic acid(CAT: L026744) is an aromatic compound featuring a benzoic acid moiety linked via a methylene bridge to a 2-formylphenoxy group. This compound is a valuable intermediate in pharmaceutical and chemical research, often used in the synthesis of bioactive molecules and complex organic frameworks. Its unique structure, combining an aldehyde and carboxylic acid functionality, allows for versatile chemical transformations, including condensation and esterification reactions. With high purity and excellent stability, 4-[(2-Formylphenoxy)methyl]benzoic acid is a key building block for innovative applications in medicinal chemistry and organic synthesis.
CAS Number | 338994-68-6 |
Molecular Formula | C15H12O4 |
Purity | ≥95% |
IUPAC Name | 4-[(2-formylphenoxy)methyl]benzoic acid |
InChI | InChI=1S/C15H12O4/c16-9-13-3-1-2-4-14(13)19-10-11-5-7-12(8-6-11)15(17)18/h1-9H,10H2,(H,17,18) |
InChIKey | HAMHSPLHZAFUHD-UHFFFAOYSA-N |
SMILES | C1=CC=C(C(=C1)C=O)OCC2=CC=C(C=C2)C(=O)O |