Home
>
Inhibitors/Agonists>Endocrinology and Hormones>Other Inhibitors> 4-(2-Methoxy-benzyl)-piperidine hydrochloride
For research use only. Not for therapeutic Use.
4-(2-Methoxy-benzyl)-piperidine hydrochloride (Cat No.:L011456) is a chemical compound with a piperidine ring substituted by a 2-methoxybenzyl group. It exists as a hydrochloride salt, being the protonated form with a chloride counterion. This compound has potential applications in medicinal chemistry and pharmaceutical research, possibly due to its structural features and interactions with biological systems. The 2-methoxybenzyl group contributes specific chemical properties, making it relevant in drug design and synthesis.
CAS Number | 37581-34-3 |
Molecular Formula | C13H20ClNO |
Purity | ≥95% |
Storage | RT |
IUPAC Name | 4-[(2-methoxyphenyl)methyl]piperidine;hydrochloride |
InChI | InChI=1S/C13H19NO.ClH/c1-15-13-5-3-2-4-12(13)10-11-6-8-14-9-7-11;/h2-5,11,14H,6-10H2,1H3;1H |
InChIKey | FOGMNBVOKCFRAG-UHFFFAOYSA-N |
SMILES | COC1=CC=CC=C1CC2CCNCC2.Cl |