Home
>
Chemical Reagents>Heterocyclic Building Blocks> 4-(2-(Pyridin-2-yl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl)quinolin-7-ol
For research use only. Not for therapeutic Use.
4-(2-(Pyridin-2-yl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl) quinoline-7-ol (Cat No.:L006679), is a complex chemical compound with a quinoline core, fused with a pyrrolopyrazole ring and a pyridine moiety. This intricate structure suggests potential applications in medicinal chemistry, often used in drug discovery research. Its specific arrangement of atoms and functional groups can interact with biological targets, making it valuable in the development of pharmaceuticals. Compounds like this are pivotal in the quest for novel drugs, as researchers explore their unique chemical properties for potential therapeutic benefits in various diseases.
Catalog Number | L006679 |
CAS Number | 476474-11-0 |
Molecular Formula | C20H16N4O |
Purity | ≥95% |
IUPAC Name | 4-(2-pyridin-2-yl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl)quinolin-7-ol |
InChI | InChI=1S/C20H16N4O/c25-13-6-7-14-15(8-10-22-17(14)12-13)19-18-5-3-11-24(18)23-20(19)16-4-1-2-9-21-16/h1-2,4,6-10,12,25H,3,5,11H2 |
InChIKey | ZDNICFYNWASODE-UHFFFAOYSA-N |
SMILES | C1CC2=C(C(=NN2C1)C3=CC=CC=N3)C4=C5C=CC(=CC5=NC=C4)O |