For research use only. Not for therapeutic Use.
4-(2-((tert-Butoxycarbonyl)amino)ethoxy)pyridine-2,6-dicarboxylic acid(Cat No.:L029432)is a complex organic compound featuring a pyridine ring substituted with a diester carboxylic acid group at the 2 and 6 positions, and a tert-butoxycarbonyl (Boc)-protected aminoethoxy group at the 4-position. This compound is valuable in pharmaceutical research and organic synthesis as a building block for the development of bioactive molecules, including drug candidates. The Boc group protects the amine during synthesis, allowing for selective deprotection and further functionalization. Its high purity ensures consistent performance in advanced research and medicinal chemistry applications.
CAS Number | 1085412-35-6 |
Molecular Formula | C14H18N2O7 |
Purity | ≥95% |
IUPAC Name | 4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]pyridine-2,6-dicarboxylic acid |
InChI | InChI=1S/C14H18N2O7/c1-14(2,3)23-13(21)15-4-5-22-8-6-9(11(17)18)16-10(7-8)12(19)20/h6-7H,4-5H2,1-3H3,(H,15,21)(H,17,18)(H,19,20) |
InChIKey | PEGTVRIHSZAVQS-UHFFFAOYSA-N |
SMILES | CC(C)(C)OC(=O)NCCOC1=CC(=NC(=C1)C(=O)O)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |