For research use only. Not for therapeutic Use.
4-(2,6-Difluorophenyl)butan-2-amine(Cat No.:L007746), is a chemical compound featuring a butylamine chain attached to a difluorinated phenyl ring. This molecule finds utility in medicinal chemistry and organic synthesis. Compounds with similar structures often serve as intermediates or building blocks in the creation of pharmaceuticals and other bioactive molecules. Researchers use this amine derivative as a key component in the development of new compounds with potential biological activities. Its distinctive structure, combining an aliphatic amine chain with a difluorinated aromatic moiety, makes it valuable for the creation of diverse organic molecules with tailored properties and functions, contributing to advancements in drug discovery and chemical research.
CAS Number | 1315373-41-1 |
Molecular Formula | C10H13F2N |
Purity | ≥95% |
IUPAC Name | 4-(2,6-difluorophenyl)butan-2-amine |
InChI | InChI=1S/C10H13F2N/c1-7(13)5-6-8-9(11)3-2-4-10(8)12/h2-4,7H,5-6,13H2,1H3 |
InChIKey | CIQBLRRBNYXOPL-UHFFFAOYSA-N |
SMILES | CC(CCC1=C(C=CC=C1F)F)N |