Home
>
Chemical Reagents>Heterocyclic Building Blocks> 4-[3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]morpholine
For research use only. Not for therapeutic Use.
4-[3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]morpholine is a chemical compound used in organic synthesis, particularly in the development of boronic acid derivatives. The boron-containing group, a tetramethyl-1,3,2-dioxaborolane moiety, enhances reactivity in cross-coupling reactions, such as Suzuki-Miyaura, making it valuable for constructing complex carbon-carbon bonds. The morpholine ring provides structural stability and facilitates solubility in various solvents, making it suitable for pharmaceutical and materials research. This compound is a useful building block in medicinal chemistry and advanced chemical synthesis.
CAS Number | 852227-95-3 |
Molecular Formula | C16H24BNO3 |
Purity | ≥95% |
IUPAC Name | 4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]morpholine |
InChI | InChI=1S/C16H24BNO3/c1-15(2)16(3,4)21-17(20-15)13-6-5-7-14(12-13)18-8-10-19-11-9-18/h5-7,12H,8-11H2,1-4H3 |
InChIKey | NCJDKFFODGZRRL-UHFFFAOYSA-N |
SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)N3CCOCC3 |