For research use only. Not for therapeutic Use.
4-(3-Chlorophenyl)-1H-pyrrole-2-carboxylic acid(Cat No.:L007510), is a chemical compound featuring a pyrrole ring with a carboxylic acid group at the 2nd position and a 3-chlorophenyl substituent. This compound is vital in medicinal chemistry and drug discovery. Researchers investigate its unique structure and reactivity to explore potential pharmacological activities. Studies focus on its interactions with biological targets, aiming to develop novel drugs. Its specific properties make it valuable in the synthesis of diverse organic compounds.
CAS Number | 1511974-79-0 |
Molecular Formula | C11H8ClNO2 |
Purity | ≥95% |
IUPAC Name | 4-(3-chlorophenyl)-1H-pyrrole-2-carboxylic acid |
InChI | InChI=1S/C11H8ClNO2/c12-9-3-1-2-7(4-9)8-5-10(11(14)15)13-6-8/h1-6,13H,(H,14,15) |
InChIKey | GVRLCPQFLJQUFU-UHFFFAOYSA-N |
SMILES | C1=CC(=CC(=C1)Cl)C2=CNC(=C2)C(=O)O |