For research use only. Not for therapeutic Use.
4-(3-Nitrophenyl)-1H-pyrazole(Cat No.:L007334), is a chemical compound with potential applications in medicinal and synthetic chemistry. This compound features a nitrophenyl group attached to a pyrazole ring, making it a valuable building block in organic synthesis. Nitrophenyl-substituted pyrazoles have been studied for their biological activities, including their potential as anti-inflammatory and anticancer agents. Researchers might employ this compound in the design and synthesis of novel pharmaceuticals, agrochemicals, or materials. Its unique structure makes it a valuable tool for the development of new molecules with diverse biological and chemical properties.
CAS Number | 1190222-97-9 |
Molecular Formula | C9H7N3O2 |
Purity | ≥95% |
IUPAC Name | 4-(3-nitrophenyl)-1H-pyrazole |
InChI | InChI=1S/C9H7N3O2/c13-12(14)9-3-1-2-7(4-9)8-5-10-11-6-8/h1-6H,(H,10,11) |
InChIKey | KLYSLFRVYACGED-UHFFFAOYSA-N |
SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C2=CNN=C2 |