For research use only. Not for therapeutic Use.
4′-(4-(1H-Tetrazol-5-yl)phenyl)-2,2′:6′,2”-terpyridine (Cat.No:L003832) is a crucial compound in coordination chemistry. Its unique terpyridine scaffold, combined with a tetrazole moiety, imparts distinctive reactivity and coordination properties. This compound is employed in the design of specialized ligands for metal complexes, with potential applications in catalysis and materials science.
Catalog Number | L003832 |
CAS Number | 1938145-37-9 |
Molecular Formula | C22H15N7 |
Purity | ≥95% |
IUPAC Name | 2,6-dipyridin-2-yl-4-[4-(2H-tetrazol-5-yl)phenyl]pyridine |
InChI | InChI=1S/C22H15N7/c1-3-11-23-18(5-1)20-13-17(14-21(25-20)19-6-2-4-12-24-19)15-7-9-16(10-8-15)22-26-28-29-27-22/h1-14H,(H,26,27,28,29) |
InChIKey | TYPVFQIUIACQTC-UHFFFAOYSA-N |
SMILES | C1=CC=NC(=C1)C2=CC(=CC(=N2)C3=CC=CC=N3)C4=CC=C(C=C4)C5=NNN=N5 |